C17H14F2N2O3S2 — CID 40891887
N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 40891887) has the molecular formula C17H14F2N2O3S2 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 40891887 |
| Molecular Formula | C17H14F2N2O3S2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | C=CCn1c(=NS(=O)(=O)c2ccc(OC)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H14F2N2O3S2/c1-3-8-21-16-14(19)9-11(18)10-15(16)25-17(21)20-26(22,23)13-6-4-12(24-2)5-7-13/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | RTENXJYZXGAVAX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|