C17H12F2N2O2S2 — CID 40849607
N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 40849607) has the molecular formula C17H12F2N2O2S2 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 40849607 |
| Molecular Formula | C17H12F2N2O2S2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | C#CCn1c(=NS(=O)(=O)c2ccc(C)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C17H12F2N2O2S2/c1-3-8-21-16-14(19)9-12(18)10-15(16)24-17(21)20-25(22,23)13-6-4-11(2)5-7-13/h1,4-7,9-10H,8H2,2H3 |
| InChIKey | MVBYPZRTGWFNTN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|