C19H14F2N2OS — CID 4099448
N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3,4-dimethylbenzamide (PubChem CID 4099448) has the molecular formula C19H14F2N2OS and a molecular weight of 356.40 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3,4-dimethylbenzamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 4099448 |
| Molecular Formula | C19H14F2N2OS |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3,4-dimethylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(C)c(C)c2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C19H14F2N2OS/c1-4-7-23-17-15(21)9-14(20)10-16(17)25-19(23)22-18(24)13-6-5-11(2)12(3)8-13/h1,5-6,8-10H,7H2,2-3H3/b22-19- |
| InChIKey | QWHYQTIMQGGJSO-QOCHGBHMSA-N |
| XLogP | 3.97 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|