C19H15F2N3OS — CID 4147800
N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(dimethylamino)benzamide (PubChem CID 4147800) has the molecular formula C19H15F2N3OS and a molecular weight of 371.41 g/mol. Its IUPAC name is N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(dimethylamino)benzamide.
| Compound Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 4147800 |
| Molecular Formula | C19H15F2N3OS |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(4,6-difluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(dimethylamino)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(N(C)C)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C19H15F2N3OS/c1-4-9-24-17-15(21)10-13(20)11-16(17)26-19(24)22-18(25)12-5-7-14(8-6-12)23(2)3/h1,5-8,10-11H,9H2,2-3H3/b22-19- |
| InChIKey | CBPQWELVCFPIPG-QOCHGBHMSA-N |
| XLogP | 3.42 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|