C18H12Cl2N2OS — CID 40885698
N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide (PubChem CID 40885698) has the molecular formula C18H12Cl2N2OS and a molecular weight of 375.28 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide |
|---|---|
| PubChem CID | 40885698 |
| Molecular Formula | C18H12Cl2N2OS |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(C)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C18H12Cl2N2OS/c1-3-8-22-16-14(20)9-13(19)10-15(16)24-18(22)21-17(23)12-6-4-11(2)5-7-12/h1,4-7,9-10H,8H2,2H3/b21-18- |
| InChIKey | HTQMJFMKOFUNJQ-UZYVYHOESA-N |
| XLogP | 4.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|