C17H9Cl2N3O3S — CID 40885730
N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide (PubChem CID 40885730) has the molecular formula C17H9Cl2N3O3S and a molecular weight of 406.25 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
|---|---|
| PubChem CID | 40885730 |
| Molecular Formula | C17H9Cl2N3O3S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C17H9Cl2N3O3S/c1-2-7-21-15-13(19)8-11(18)9-14(15)26-17(21)20-16(23)10-3-5-12(6-4-10)22(24)25/h1,3-6,8-9H,7H2/b20-17- |
| InChIKey | LUEJBMSDSQIVJT-JZJYNLBNSA-N |
| XLogP | 4.29 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|