C17H10ClN3O3S — CID 4171602
4-chloro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4171602) has the molecular formula C17H10ClN3O3S and a molecular weight of 371.81 g/mol. Its IUPAC name is 4-chloro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-chloro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4171602 |
| Molecular Formula | C17H10ClN3O3S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 4-chloro-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(Cl)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H10ClN3O3S/c1-2-9-20-14-8-7-13(21(23)24)10-15(14)25-17(20)19-16(22)11-3-5-12(18)6-4-11/h1,3-8,10H,9H2/b19-17- |
| InChIKey | MCTKTNXNGUUJFE-ZPHPHTNESA-N |
| XLogP | 3.64 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|