C18H11Cl2N3O4S — CID 4189118
2-(2,4-dichlorophenoxy)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 4189118) has the molecular formula C18H11Cl2N3O4S and a molecular weight of 436.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 4189118 |
| Molecular Formula | C18H11Cl2N3O4S |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)COc2ccc(Cl)cc2Cl)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H11Cl2N3O4S/c1-2-7-22-14-5-4-12(23(25)26)9-16(14)28-18(22)21-17(24)10-27-15-6-3-11(19)8-13(15)20/h1,3-6,8-9H,7,10H2/b21-18- |
| InChIKey | RVFDVOHHFJGAIS-UZYVYHOESA-N |
| XLogP | 4.06 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|