C18H12ClN3O3S2 — CID 16852013
2-(4-chlorophenyl)sulfanyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 16852013) has the molecular formula C18H12ClN3O3S2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 16852013 |
| Molecular Formula | C18H12ClN3O3S2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)CSc2ccc(Cl)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C18H12ClN3O3S2/c1-2-9-21-15-10-13(22(24)25)5-8-16(15)27-18(21)20-17(23)11-26-14-6-3-12(19)4-7-14/h1,3-8,10H,9,11H2/b20-18- |
| InChIKey | UZZQMAQUEYBYSC-ZZEZOPTASA-N |
| XLogP | 4.12 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|