C19H18ClN3O3S2 — CID 16850948
4-(4-chlorophenyl)sulfanyl-N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 16850948) has the molecular formula C19H18ClN3O3S2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 16850948 |
| Molecular Formula | C19H18ClN3O3S2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | CCn1/c(=N/C(=O)CCCSc2ccc(Cl)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H18ClN3O3S2/c1-2-22-16-12-14(23(25)26)7-10-17(16)28-19(22)21-18(24)4-3-11-27-15-8-5-13(20)6-9-15/h5-10,12H,2-4,11H2,1H3/b21-19- |
| InChIKey | RYBSMSIHGNCIKL-VZCXRCSSSA-N |
| XLogP | 5.28 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|