C20H21N3O6S2 — CID 16850954
N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-(4-methoxyphenyl)sulfonylbutanamide (PubChem CID 16850954) has the molecular formula C20H21N3O6S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-(4-methoxyphenyl)sulfonylbutanamide.
| Compound Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-(4-methoxyphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 16850954 |
| Molecular Formula | C20H21N3O6S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-(4-methoxyphenyl)sulfonylbutanamide |
| SMILES | CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(OC)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H21N3O6S2/c1-3-22-17-13-14(23(25)26)6-11-18(17)30-20(22)21-19(24)5-4-12-31(27,28)16-9-7-15(29-2)8-10-16/h6-11,13H,3-5,12H2,1-2H3/b21-20- |
| InChIKey | IDZYXQKVOGIXMW-MRCUWXFGSA-N |
| XLogP | 3.32 |
| TPSA | 120.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|