C19H16FN3O7S2 — CID 16851473
methyl 2-[2-[3-(4-fluorophenyl)sulfonylpropanoylimino]-5-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16851473) has the molecular formula C19H16FN3O7S2 and a molecular weight of 481.48 g/mol. Its IUPAC name is methyl 2-[2-[3-(4-fluorophenyl)sulfonylpropanoylimino]-5-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-[3-(4-fluorophenyl)sulfonylpropanoylimino]-5-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16851473 |
| Molecular Formula | C19H16FN3O7S2 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | methyl 2-[2-[3-(4-fluorophenyl)sulfonylpropanoylimino]-5-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)CCS(=O)(=O)c2ccc(F)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H16FN3O7S2/c1-30-18(25)11-22-15-10-13(23(26)27)4-7-16(15)31-19(22)21-17(24)8-9-32(28,29)14-5-2-12(20)3-6-14/h2-7,10H,8-9,11H2,1H3/b21-19- |
| InChIKey | MHOLURRFYBNHMT-VZCXRCSSSA-N |
| XLogP | 2.21 |
| TPSA | 137.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|