C16H12FN3O6S2 — CID 16937881
methyl 2-[(2Z)-2-(4-fluorophenyl)sulfonylimino-6-nitro-1,3-benzothiazol-3-yl]acetate (PubChem CID 16937881) has the molecular formula C16H12FN3O6S2 and a molecular weight of 425.42 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-(4-fluorophenyl)sulfonylimino-6-nitro-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[(2Z)-2-(4-fluorophenyl)sulfonylimino-6-nitro-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 16937881 |
| Molecular Formula | C16H12FN3O6S2 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | methyl 2-[(2Z)-2-(4-fluorophenyl)sulfonylimino-6-nitro-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/S(=O)(=O)c2ccc(F)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H12FN3O6S2/c1-26-15(21)9-19-13-7-4-11(20(22)23)8-14(13)27-16(19)18-28(24,25)12-5-2-10(17)3-6-12/h2-8H,9H2,1H3/b18-16- |
| InChIKey | SUPXTLOPVULPKA-VLGSPTGOSA-N |
| XLogP | 2.21 |
| TPSA | 120.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|