C16H15N3O5S2 — CID 40891781
N-(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 40891781) has the molecular formula C16H15N3O5S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | N-(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 40891781 |
| Molecular Formula | C16H15N3O5S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-(3-ethyl-6-nitro-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | CCn1c(=NS(=O)(=O)c2ccc(OC)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H15N3O5S2/c1-3-18-14-9-4-11(19(20)21)10-15(14)25-16(18)17-26(22,23)13-7-5-12(24-2)6-8-13/h4-10H,3H2,1-2H3 |
| InChIKey | CSXJMVIQTUQRJE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|