C18H19ClN2O4S2 — CID 16937445
(NZ)-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 16937445) has the molecular formula C18H19ClN2O4S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is (NZ)-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16937445 |
| Molecular Formula | C18H19ClN2O4S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (NZ)-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(OC)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H19ClN2O4S2/c1-3-25-11-10-21-16-9-4-13(19)12-17(16)26-18(21)20-27(22,23)15-7-5-14(24-2)6-8-15/h4-9,12H,3,10-11H2,1-2H3/b20-18- |
| InChIKey | LWZOGKMDWNNNOU-ZZEZOPTASA-N |
| XLogP | 3.69 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|