C24H28ClN3O5S2 — CID 16863166
N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16863166) has the molecular formula C24H28ClN3O5S2 and a molecular weight of 538.09 g/mol. Its IUPAC name is N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863166 |
| Molecular Formula | C24H28ClN3O5S2 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(OC)cc3)C2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H28ClN3O5S2/c1-3-33-14-13-28-21-11-6-18(25)15-22(21)34-24(28)26-23(29)17-5-4-12-27(16-17)35(30,31)20-9-7-19(32-2)8-10-20/h6-11,15,17H,3-5,12-14,16H2,1-2H3/b26-24- |
| InChIKey | ACMOHUKSCURGGJ-LCUIJRPUSA-N |
| XLogP | 3.93 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|