C24H28ClN3O4S2 — CID 16863165
N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16863165) has the molecular formula C24H28ClN3O4S2 and a molecular weight of 522.09 g/mol. Its IUPAC name is N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863165 |
| Molecular Formula | C24H28ClN3O4S2 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(C)cc3)C2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H28ClN3O4S2/c1-3-32-14-13-28-21-11-8-19(25)15-22(21)33-24(28)26-23(29)18-5-4-12-27(16-18)34(30,31)20-9-6-17(2)7-10-20/h6-11,15,18H,3-5,12-14,16H2,1-2H3/b26-24- |
| InChIKey | QBBMWFCKOWPIGK-LCUIJRPUSA-N |
| XLogP | 4.23 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|