C25H31N3O4S2 — CID 16863160
N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16863160) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863160 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(C)cc3)C2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C25H31N3O4S2/c1-4-32-15-14-28-22-12-9-19(3)16-23(22)33-25(28)26-24(29)20-6-5-13-27(17-20)34(30,31)21-10-7-18(2)8-11-21/h7-12,16,20H,4-6,13-15,17H2,1-3H3/b26-25- |
| InChIKey | MHEPDNIGTZPPEH-QPLCGJKRSA-N |
| XLogP | 3.88 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|