C26H33N3O5S2 — CID 16863356
N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 16863356) has the molecular formula C26H33N3O5S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16863356 |
| Molecular Formula | C26H33N3O5S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-1-(4-methoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccc(OC)cc3)C2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C26H33N3O5S2/c1-5-34-14-13-29-23-15-18(2)19(3)16-24(23)35-26(29)27-25(30)20-7-6-12-28(17-20)36(31,32)22-10-8-21(33-4)9-11-22/h8-11,15-16,20H,5-7,12-14,17H2,1-4H3/b27-26- |
| InChIKey | KXMMZLGKOPXSIG-RQZHXJHFSA-N |
| XLogP | 3.89 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|