C19H21FN2O5S2 — CID 16937965
(NZ)-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 16937965) has the molecular formula C19H21FN2O5S2 and a molecular weight of 440.52 g/mol. Its IUPAC name is (NZ)-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | (NZ)-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16937965 |
| Molecular Formula | C19H21FN2O5S2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (NZ)-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(F)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H21FN2O5S2/c1-4-27-10-9-22-15-11-16(25-2)17(26-3)12-18(15)28-19(22)21-29(23,24)14-7-5-13(20)6-8-14/h5-8,11-12H,4,9-10H2,1-3H3/b21-19- |
| InChIKey | SRDJZTQHWKPRSM-VZCXRCSSSA-N |
| XLogP | 3.19 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|