C19H20FN3O4S2 — CID 16937867
N-[(2Z)-3-(2-ethoxyethyl)-2-(4-fluorophenyl)sulfonylimino-1,3-benzothiazol-6-yl]acetamide (PubChem CID 16937867) has the molecular formula C19H20FN3O4S2 and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[(2Z)-3-(2-ethoxyethyl)-2-(4-fluorophenyl)sulfonylimino-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[(2Z)-3-(2-ethoxyethyl)-2-(4-fluorophenyl)sulfonylimino-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 16937867 |
| Molecular Formula | C19H20FN3O4S2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[(2Z)-3-(2-ethoxyethyl)-2-(4-fluorophenyl)sulfonylimino-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2ccc(F)cc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C19H20FN3O4S2/c1-3-27-11-10-23-17-9-6-15(21-13(2)24)12-18(17)28-19(23)22-29(25,26)16-7-4-14(20)5-8-16/h4-9,12H,3,10-11H2,1-2H3,(H,21,24)/b22-19- |
| InChIKey | HYZPFAZVPOEMDL-QOCHGBHMSA-N |
| XLogP | 3.13 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|