C26H25FN4O5S2 — CID 121044537
N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 121044537) has the molecular formula C26H25FN4O5S2 and a molecular weight of 556.64 g/mol. Its IUPAC name is N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121044537 |
| Molecular Formula | C26H25FN4O5S2 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C26H25FN4O5S2/c1-3-36-15-14-31-23-13-10-21(28-17(2)32)16-24(23)37-26(31)29-25(33)18-4-8-20(9-5-18)30-38(34,35)22-11-6-19(27)7-12-22/h4-13,16,30H,3,14-15H2,1-2H3,(H,28,32)/b29-26- |
| InChIKey | MIGNVINBTQBIQK-WCTVFOPTSA-N |
| XLogP | 4.38 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|