C26H32N4O5S2 — CID 4117579
N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 4117579) has the molecular formula C26H32N4O5S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 4117579 |
| Molecular Formula | C26H32N4O5S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C26H32N4O5S2/c1-4-35-16-15-30-23-10-7-21(27-19(3)31)17-24(23)36-26(30)28-25(32)20-5-8-22(9-6-20)37(33,34)29-13-11-18(2)12-14-29/h5-10,17-18H,4,11-16H2,1-3H3,(H,27,31)/b28-26- |
| InChIKey | LUJFTCZHNFFFBE-SGEDCAFJSA-N |
| XLogP | 3.86 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|