C23H26BrN3O4S2 — CID 4257717
N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 4257717) has the molecular formula C23H26BrN3O4S2 and a molecular weight of 552.52 g/mol. Its IUPAC name is N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4257717 |
| Molecular Formula | C23H26BrN3O4S2 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C23H26BrN3O4S2/c1-2-31-15-14-27-20-11-8-18(24)16-21(20)32-23(27)25-22(28)17-6-9-19(10-7-17)33(29,30)26-12-4-3-5-13-26/h6-11,16H,2-5,12-15H2,1H3/b25-23- |
| InChIKey | LMKXYHHSZKFZBF-BZZOAKBMSA-N |
| XLogP | 4.42 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|