C26H34BrN3O4S2 — CID 5063208
N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dibutylsulfamoyl)benzamide (PubChem CID 5063208) has the molecular formula C26H34BrN3O4S2 and a molecular weight of 596.61 g/mol. Its IUPAC name is N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dibutylsulfamoyl)benzamide.
| Compound Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dibutylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5063208 |
| Molecular Formula | C26H34BrN3O4S2 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | N-[6-bromo-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dibutylsulfamoyl)benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(Br)ccc3n2CCOCC)cc1 |
| InChI | InChI=1S/C26H34BrN3O4S2/c1-4-7-15-29(16-8-5-2)36(32,33)22-12-9-20(10-13-22)25(31)28-26-30(17-18-34-6-3)23-14-11-21(27)19-24(23)35-26/h9-14,19H,4-8,15-18H2,1-3H3/b28-26- |
| InChIKey | KWBYGJPXRYYJRT-SGEDCAFJSA-N |
| XLogP | 5.83 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|