C27H37N3O3S2 — CID 43984161
4-(dibutylsulfamoyl)-N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43984161) has the molecular formula C27H37N3O3S2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43984161 |
| Molecular Formula | C27H37N3O3S2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(CC)ccc3n2CCC)cc1 |
| InChI | InChI=1S/C27H37N3O3S2/c1-5-9-18-29(19-10-6-2)35(32,33)23-14-12-22(13-15-23)26(31)28-27-30(17-7-3)24-16-11-21(8-4)20-25(24)34-27/h11-16,20H,5-10,17-19H2,1-4H3/b28-27- |
| InChIKey | ADYOZPFUKMIXKP-DQSJHHFOSA-N |
| XLogP | 6.01 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |