C25H29N3O5S2 — CID 40997108
4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40997108) has the molecular formula C25H29N3O5S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40997108 |
| Molecular Formula | C25H29N3O5S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCOC)CCOC)cc2)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C25H29N3O5S2/c1-5-13-28-22-12-7-19(6-2)18-23(22)34-25(28)26-24(29)20-8-10-21(11-9-20)35(30,31)27(14-16-32-3)15-17-33-4/h1,7-12,18H,6,13-17H2,2-4H3/b26-25- |
| InChIKey | FTMBIRZGWYDTAR-QPLCGJKRSA-N |
| XLogP | 2.92 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|