C24H27N3O5S3 — CID 4215198
4-[butyl(ethyl)sulfamoyl]-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4215198) has the molecular formula C24H27N3O5S3 and a molecular weight of 533.70 g/mol. Its IUPAC name is 4-[butyl(ethyl)sulfamoyl]-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4215198 |
| Molecular Formula | C24H27N3O5S3 |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 4-[butyl(ethyl)sulfamoyl]-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)CCCC)cc2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H27N3O5S3/c1-5-8-16-26(7-3)35(31,32)19-11-9-18(10-12-19)23(28)25-24-27(15-6-2)21-14-13-20(34(4,29)30)17-22(21)33-24/h2,9-14,17H,5,7-8,15-16H2,1,3-4H3/b25-24- |
| InChIKey | FSDXVZXRLDZLET-IZHYLOQSSA-N |
| XLogP | 3.29 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|