C23H24N2O4S2 — CID 3614888
N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-pentoxybenzamide (PubChem CID 3614888) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-pentoxybenzamide.
| Compound Name | N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-pentoxybenzamide |
|---|---|
| PubChem CID | 3614888 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-pentoxybenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(OCCCCC)c2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H24N2O4S2/c1-4-6-7-14-29-18-10-8-9-17(15-18)22(26)24-23-25(13-5-2)20-12-11-19(31(3,27)28)16-21(20)30-23/h2,8-12,15-16H,4,6-7,13-14H2,1,3H3/b24-23- |
| InChIKey | BJSUTPIGJMVCAM-VHXPQNKSSA-N |
| XLogP | 4.05 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|