C22H22N2O3S2 — CID 40952183
N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfonylbenzamide (PubChem CID 40952183) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfonylbenzamide.
| Compound Name | N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 40952183 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfonylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(S(C)(=O)=O)c2)sc2cc(CCCC)ccc21 |
| InChI | InChI=1S/C22H22N2O3S2/c1-4-6-8-16-11-12-19-20(14-16)28-22(24(19)13-5-2)23-21(25)17-9-7-10-18(15-17)29(3,26)27/h2,7,9-12,14-15H,4,6,8,13H2,1,3H3/b23-22- |
| InChIKey | OGGKUHUQNTUHRK-FCQUAONHSA-N |
| XLogP | 3.82 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|