C18H22N2OS — CID 40996912
N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylpropanamide (PubChem CID 40996912) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylpropanamide.
| Compound Name | N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylpropanamide |
|---|---|
| PubChem CID | 40996912 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(6-butyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylpropanamide |
| SMILES | C#CCn1/c(=N/C(=O)C(C)C)sc2cc(CCCC)ccc21 |
| InChI | InChI=1S/C18H22N2OS/c1-5-7-8-14-9-10-15-16(12-14)22-18(20(15)11-6-2)19-17(21)13(3)4/h2,9-10,12-13H,5,7-8,11H2,1,3-4H3/b19-18- |
| InChIKey | DXKAPWKFMALKDG-HNENSFHCSA-N |
| XLogP | 3.76 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|