C21H20N2OS — CID 41342685
2-(2,5-dimethylphenyl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 41342685) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 41342685 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cc(C)ccc2C)sc2cc(C)ccc21 |
| InChI | InChI=1S/C21H20N2OS/c1-5-10-23-18-9-7-15(3)12-19(18)25-21(23)22-20(24)13-17-11-14(2)6-8-16(17)4/h1,6-9,11-12H,10,13H2,2-4H3/b22-21- |
| InChIKey | LUTQDXMHKLYAOD-DQRAZIAOSA-N |
| XLogP | 3.93 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|