C20H18N2O3S2 — CID 43945305
2-(3-methylphenyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 43945305) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(3-methylphenyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 43945305 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-(3-methylphenyl)-N-(6-methylsulfonyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccc(C)c2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H18N2O3S2/c1-4-10-22-17-9-8-16(27(3,24)25)13-18(17)26-20(22)21-19(23)12-15-7-5-6-14(2)11-15/h1,5-9,11,13H,10,12H2,2-3H3/b21-20- |
| InChIKey | UTTMDJFOOPWHNR-MRCUWXFGSA-N |
| XLogP | 2.72 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|