C21H20N2O3S — CID 16912518
N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methoxyphenyl)acetamide (PubChem CID 16912518) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16912518 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methoxyphenyl)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccc(OC)c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C21H20N2O3S/c1-4-11-23-18-10-9-17(26-5-2)14-19(18)27-21(23)22-20(24)13-15-7-6-8-16(12-15)25-3/h1,6-10,12,14H,5,11,13H2,2-3H3/b22-21- |
| InChIKey | WCHNPRKLRFDDNU-DQRAZIAOSA-N |
| XLogP | 3.41 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|