C23H18N2O2S — CID 3301758
N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide (PubChem CID 3301758) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide.
| Compound Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3301758 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)naphthalene-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc3ccccc3c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C23H18N2O2S/c1-3-13-25-20-12-11-19(27-4-2)15-21(20)28-23(25)24-22(26)18-10-9-16-7-5-6-8-17(16)14-18/h1,5-12,14-15H,4,13H2,2H3/b24-23- |
| InChIKey | KVTDCQQSSMOINW-VHXPQNKSSA-N |
| XLogP | 4.63 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|