C19H14Cl2N2O2S — CID 4066731
2,5-dichloro-N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4066731) has the molecular formula C19H14Cl2N2O2S and a molecular weight of 405.31 g/mol. Its IUPAC name is 2,5-dichloro-N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,5-dichloro-N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4066731 |
| Molecular Formula | C19H14Cl2N2O2S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2,5-dichloro-N-(6-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(Cl)ccc2Cl)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C19H14Cl2N2O2S/c1-3-9-23-16-8-6-13(25-4-2)11-17(16)26-19(23)22-18(24)14-10-12(20)5-7-15(14)21/h1,5-8,10-11H,4,9H2,2H3/b22-19- |
| InChIKey | LWNIXGTZFWXMBD-QOCHGBHMSA-N |
| XLogP | 4.78 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|