C17H9Cl3N2OS — CID 43946182
2,5-dichloro-N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43946182) has the molecular formula C17H9Cl3N2OS and a molecular weight of 395.70 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,5-dichloro-N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43946182 |
| Molecular Formula | C17H9Cl3N2OS |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 2,5-dichloro-N-(4-chloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(Cl)ccc2Cl)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C17H9Cl3N2OS/c1-2-8-22-15-13(20)4-3-5-14(15)24-17(22)21-16(23)11-9-10(18)6-7-12(11)19/h1,3-7,9H,8H2/b21-17- |
| InChIKey | WXHDLZNDKAHCFU-FXBPSFAMSA-N |
| XLogP | 5.04 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|