C18H10Cl2N2O3S — CID 41007011
2,5-dichloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide (PubChem CID 41007011) has the molecular formula C18H10Cl2N2O3S and a molecular weight of 405.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide.
| Compound Name | 2,5-dichloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
|---|---|
| PubChem CID | 41007011 |
| Molecular Formula | C18H10Cl2N2O3S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 2,5-dichloro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(Cl)ccc2Cl)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H10Cl2N2O3S/c1-2-5-22-13-7-14-15(25-9-24-14)8-16(13)26-18(22)21-17(23)11-6-10(19)3-4-12(11)20/h1,3-4,6-8H,5,9H2/b21-18- |
| InChIKey | CURQGPBKJPRXHK-UZYVYHOESA-N |
| XLogP | 4.11 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|