C27H17N3O3S — CID 43978665
2-phenyl-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)quinoline-4-carboxamide (PubChem CID 43978665) has the molecular formula C27H17N3O3S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-phenyl-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)quinoline-4-carboxamide.
| Compound Name | 2-phenyl-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 43978665 |
| Molecular Formula | C27H17N3O3S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-phenyl-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)quinoline-4-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(-c3ccccc3)nc3ccccc23)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C27H17N3O3S/c1-2-12-30-22-14-23-24(33-16-32-23)15-25(22)34-27(30)29-26(31)19-13-21(17-8-4-3-5-9-17)28-20-11-7-6-10-18(19)20/h1,3-11,13-15H,12,16H2/b29-27- |
| InChIKey | MWKPHDBEJRGRGW-OHYPFYFLSA-N |
| XLogP | 5.02 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|