C20H16N2O5S2 — CID 41007457
3-(benzenesulfonyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)propanamide (PubChem CID 41007457) has the molecular formula C20H16N2O5S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)propanamide |
|---|---|
| PubChem CID | 41007457 |
| Molecular Formula | C20H16N2O5S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)propanamide |
| SMILES | C#CCn1/c(=N/C(=O)CCS(=O)(=O)c2ccccc2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C20H16N2O5S2/c1-2-9-22-15-11-16-17(27-13-26-16)12-18(15)28-20(22)21-19(23)8-10-29(24,25)14-6-4-3-5-7-14/h1,3-7,11-12H,8-10,13H2/b21-20- |
| InChIKey | ZXTWYNNIIZMEEG-MRCUWXFGSA-N |
| XLogP | 2.36 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|