C16H10N2O3S2 — CID 40508714
N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-carboxamide (PubChem CID 40508714) has the molecular formula C16H10N2O3S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-carboxamide.
| Compound Name | N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40508714 |
| Molecular Formula | C16H10N2O3S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)thiophene-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccs2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H10N2O3S2/c1-2-5-18-10-7-11-12(21-9-20-11)8-14(10)23-16(18)17-15(19)13-4-3-6-22-13/h1,3-4,6-8H,5,9H2/b17-16- |
| InChIKey | DBQSXKMMGDFLLH-MSUUIHNZSA-N |
| XLogP | 2.87 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|