C18H10ClN3O5S — CID 41007375
2-chloro-5-nitro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide (PubChem CID 41007375) has the molecular formula C18H10ClN3O5S and a molecular weight of 415.81 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide.
| Compound Name | 2-chloro-5-nitro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
|---|---|
| PubChem CID | 41007375 |
| Molecular Formula | C18H10ClN3O5S |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 2-chloro-5-nitro-N-(7-prop-2-ynyl-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc([N+](=O)[O-])ccc2Cl)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H10ClN3O5S/c1-2-5-21-13-7-14-15(27-9-26-14)8-16(13)28-18(21)20-17(23)11-6-10(22(24)25)3-4-12(11)19/h1,3-4,6-8H,5,9H2/b20-18- |
| InChIKey | JILGNRPSFJPKIF-ZZEZOPTASA-N |
| XLogP | 3.37 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|