C17H13N3O4S — CID 43945756
2,5-dimethyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-3-carboxamide (PubChem CID 43945756) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2,5-dimethyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-3-carboxamide |
|---|---|
| PubChem CID | 43945756 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2,5-dimethyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-3-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(C)oc2C)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H13N3O4S/c1-4-7-19-14-6-5-12(20(22)23)9-15(14)25-17(19)18-16(21)13-8-10(2)24-11(13)3/h1,5-6,8-9H,7H2,2-3H3/b18-17- |
| InChIKey | UAFUMXNGBBRGIX-ZCXUNETKSA-N |
| XLogP | 3.20 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|