C15H10N4O4S — CID 16880091
3-methyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide (PubChem CID 16880091) has the molecular formula C15H10N4O4S and a molecular weight of 342.34 g/mol. Its IUPAC name is 3-methyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16880091 |
| Molecular Formula | C15H10N4O4S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-methyl-N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(C)no2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H10N4O4S/c1-3-6-18-11-5-4-10(19(21)22)8-13(11)24-15(18)16-14(20)12-7-9(2)17-23-12/h1,4-5,7-8H,6H2,2H3/b16-15- |
| InChIKey | IDLAGTSXGRJLHS-NXVVXOECSA-N |
| XLogP | 2.28 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|