C17H15N3O4S — CID 16880136
N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 16880136) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16880136 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(C)no2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C17H15N3O4S/c1-5-6-20-11-8-12(22-3)13(23-4)9-15(11)25-17(20)18-16(21)14-7-10(2)19-24-14/h1,7-9H,6H2,2-4H3/b18-17- |
| InChIKey | SEVFWNYSVXEPDE-ZCXUNETKSA-N |
| XLogP | 2.39 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|