C21H18N2O5S — CID 43945502
methyl 2-[(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate (PubChem CID 43945502) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is methyl 2-[(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate.
| Compound Name | methyl 2-[(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate |
|---|---|
| PubChem CID | 43945502 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | methyl 2-[(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)carbamoyl]benzoate |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2C(=O)OC)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C21H18N2O5S/c1-5-10-23-15-11-16(26-2)17(27-3)12-18(15)29-21(23)22-19(24)13-8-6-7-9-14(13)20(25)28-4/h1,6-9,11-12H,10H2,2-4H3/b22-21- |
| InChIKey | WABRKYSLSIDTAM-DQRAZIAOSA-N |
| XLogP | 2.88 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|