C19H15ClN2O3S — CID 40694717
3-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40694717) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is 3-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40694717 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-chloro-N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(Cl)c2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H15ClN2O3S/c1-4-8-22-14-10-15(24-2)16(25-3)11-17(14)26-19(22)21-18(23)12-6-5-7-13(20)9-12/h1,5-7,9-11H,8H2,2-3H3/b21-19- |
| InChIKey | WYAYTHNITJYILR-VZCXRCSSSA-N |
| XLogP | 3.75 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|