C20H18N2O5S2 — CID 40952132
N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylsulfonylbenzamide (PubChem CID 40952132) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylsulfonylbenzamide.
| Compound Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 40952132 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-(5,6-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-methylsulfonylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2S(C)(=O)=O)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C20H18N2O5S2/c1-5-10-22-14-11-15(26-2)16(27-3)12-17(14)28-20(22)21-19(23)13-8-6-7-9-18(13)29(4,24)25/h1,6-9,11-12H,10H2,2-4H3/b21-20- |
| InChIKey | HSNZQUNCERXHMX-MRCUWXFGSA-N |
| XLogP | 2.50 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|