C21H18N2O5S2 — CID 41004938
methyl 2-(2-ethylsulfonylbenzoyl)imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 41004938) has the molecular formula C21H18N2O5S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is methyl 2-(2-ethylsulfonylbenzoyl)imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(2-ethylsulfonylbenzoyl)imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 41004938 |
| Molecular Formula | C21H18N2O5S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | methyl 2-(2-ethylsulfonylbenzoyl)imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2ccccc2S(=O)(=O)CC)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C21H18N2O5S2/c1-4-12-23-16-11-10-14(20(25)28-3)13-17(16)29-21(23)22-19(24)15-8-6-7-9-18(15)30(26,27)5-2/h1,6-11,13H,5,12H2,2-3H3/b22-21- |
| InChIKey | OGLBTJZMRHMZTC-DQRAZIAOSA-N |
| XLogP | 2.66 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|