C21H14N2O4S — CID 40700215
methyl 2-(1-benzofuran-2-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 40700215) has the molecular formula C21H14N2O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is methyl 2-(1-benzofuran-2-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(1-benzofuran-2-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40700215 |
| Molecular Formula | C21H14N2O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 2-(1-benzofuran-2-carbonylimino)-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)c2cc3ccccc3o2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C21H14N2O4S/c1-3-10-23-15-9-8-14(20(25)26-2)12-18(15)28-21(23)22-19(24)17-11-13-6-4-5-7-16(13)27-17/h1,4-9,11-12H,10H2,2H3/b22-21- |
| InChIKey | FRPMHEKSZMFYIR-DQRAZIAOSA-N |
| XLogP | 3.61 |
| TPSA | 73.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|